About 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole
4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole (PubChem CID 90255703) has the molecular formula C9H13N3S
and a molecular weight of 195.29 g/mol. Its IUPAC name is 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole.
Analyze 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole?
The IUPAC name of 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole (CID 90255703) is 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole.
What is the SMILES notation for 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole?
The canonical SMILES for 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole is Cn1cnc(C2=NC(C)(C)CS2)c1.
What is the InChIKey of 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole?
The InChIKey is PBZIOBIQKHPNOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3S/c1-9(2)5-13-8(11-9)7-4-12(3)6-10-7/h4,6H,5H2,1-3H3.
What are the key properties of 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole?
4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole has a molecular weight of 195.29 g/mol, XLogP of 1.69, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-dimethyl-2-(1-methylimidazol-4-yl)-5H-1,3-thiazole is sourced from PubChem (CID 90255703), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).