C17H20N2O4S — CID 9025602
N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-methylsulfonyl-2-nitroaniline (PubChem CID 9025602) has the molecular formula C17H20N2O4S and a molecular weight of 348.42 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-methylsulfonyl-2-nitroaniline.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-methylsulfonyl-2-nitroaniline |
|---|---|
| PubChem CID | 9025602 |
| Molecular Formula | C17H20N2O4S |
| Molecular Weight | 348.42 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N-methyl-4-methylsulfonyl-2-nitroaniline |
| SMILES | Cc1ccc(CN(C)c2ccc(S(C)(=O)=O)cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C17H20N2O4S/c1-12-5-6-14(13(2)9-12)11-18(3)16-8-7-15(24(4,22)23)10-17(16)19(20)21/h5-10H,11H2,1-4H3 |
| InChIKey | MXRGOLPARLUXQJ-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|