C15H18N3O2+ — CID 9029967
N-[(2,4-dimethylphenyl)methyl]-N-methyl-3-nitropyridin-1-ium-2-amine (PubChem CID 9029967) has the molecular formula C15H18N3O2+ and a molecular weight of 272.33 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-N-methyl-3-nitropyridin-1-ium-2-amine.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-N-methyl-3-nitropyridin-1-ium-2-amine |
|---|---|
| PubChem CID | 9029967 |
| Molecular Formula | C15H18N3O2+ |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-N-methyl-3-nitropyridin-1-ium-2-amine |
| SMILES | Cc1ccc(CN(C)c2[nH+]cccc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C15H17N3O2/c1-11-6-7-13(12(2)9-11)10-17(3)15-14(18(19)20)5-4-8-16-15/h4-9H,10H2,1-3H3/p+1 |
| InChIKey | NEMUDNJJQZLPLQ-UHFFFAOYSA-O |
| XLogP | 2.66 |
| TPSA | 60.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|