C16H18ClN4O3+ — CID 9112894
N-(5-chloro-2-methylphenyl)-2-[ethyl-(3-nitropyridin-1-ium-2-yl)amino]acetamide (PubChem CID 9112894) has the molecular formula C16H18ClN4O3+ and a molecular weight of 349.80 g/mol. Its IUPAC name is N-(5-chloro-2-methylphenyl)-2-[ethyl-(3-nitropyridin-1-ium-2-yl)amino]acetamide.
| Compound Name | N-(5-chloro-2-methylphenyl)-2-[ethyl-(3-nitropyridin-1-ium-2-yl)amino]acetamide |
|---|---|
| PubChem CID | 9112894 |
| Molecular Formula | C16H18ClN4O3+ |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-(5-chloro-2-methylphenyl)-2-[ethyl-(3-nitropyridin-1-ium-2-yl)amino]acetamide |
| SMILES | CCN(CC(=O)Nc1cc(Cl)ccc1C)c1[nH+]cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H17ClN4O3/c1-3-20(16-14(21(23)24)5-4-8-18-16)10-15(22)19-13-9-12(17)7-6-11(13)2/h4-9H,3,10H2,1-2H3,(H,19,22)/p+1 |
| InChIKey | AMKVDAIJTGFUDF-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|