C14H19ClN4O4 — CID 9433109
2-[[2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethylamino]-N-ethylacetamide (PubChem CID 9433109) has the molecular formula C14H19ClN4O4 and a molecular weight of 342.78 g/mol. Its IUPAC name is 2-[[2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethylamino]-N-ethylacetamide.
| Compound Name | 2-[[2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethylamino]-N-ethylacetamide |
|---|---|
| PubChem CID | 9433109 |
| Molecular Formula | C14H19ClN4O4 |
| Molecular Weight | 342.78 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 2-[[2-(5-chloro-2-nitroanilino)-2-oxoethyl]-ethylamino]-N-ethylacetamide |
| SMILES | CCNC(=O)CN(CC)CC(=O)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19ClN4O4/c1-3-16-13(20)8-18(4-2)9-14(21)17-11-7-10(15)5-6-12(11)19(22)23/h5-7H,3-4,8-9H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | LFPRUVVHNYKQFC-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.78 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|