C14H21NaO3S — CID 90257128
sodium 2-octan-4-ylbenzenesulfonate (PubChem CID 90257128) has the molecular formula C14H21NaO3S and a molecular weight of 292.38 g/mol. Its IUPAC name is sodium 2-octan-4-ylbenzenesulfonate.
| Compound Name | sodium 2-octan-4-ylbenzenesulfonate |
|---|---|
| PubChem CID | 90257128 |
| Molecular Formula | C14H21NaO3S |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | sodium 2-octan-4-ylbenzenesulfonate |
| SMILES | CCCCC(CCC)c1ccccc1S(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C14H22O3S.Na/c1-3-5-9-12(8-4-2)13-10-6-7-11-14(13)18(15,16)17;/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,15,16,17);/q;+1/p-1 |
| InChIKey | VSGGAUDEUNPGII-UHFFFAOYSA-M |
| XLogP | 0.67 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|