C16H21N3O3 — CID 90259251
2-(3-hydroxy-2-oxo-1-piperidin-4-ylindol-3-yl)-N-methylacetamide (PubChem CID 90259251) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(3-hydroxy-2-oxo-1-piperidin-4-ylindol-3-yl)-N-methylacetamide.
| Compound Name | 2-(3-hydroxy-2-oxo-1-piperidin-4-ylindol-3-yl)-N-methylacetamide |
|---|---|
| PubChem CID | 90259251 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 2-(3-hydroxy-2-oxo-1-piperidin-4-ylindol-3-yl)-N-methylacetamide |
| SMILES | CNC(=O)CC1(O)C(=O)N(C2CCNCC2)c2ccccc21 |
| InChI | InChI=1S/C16H21N3O3/c1-17-14(20)10-16(22)12-4-2-3-5-13(12)19(15(16)21)11-6-8-18-9-7-11/h2-5,11,18,22H,6-10H2,1H3,(H,17,20) |
| InChIKey | PTPMUGBQRPHZKI-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |