C29H49NO8 — CID 90259923
tert-butyl N-[(8S,9S)-8-cyclopent-2-en-1-yloxy-9-methyl-2-oxo-7-pentoxyoxonan-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate (PubChem CID 90259923) has the molecular formula C29H49NO8 and a molecular weight of 539.71 g/mol. Its IUPAC name is tert-butyl N-[(8S,9S)-8-cyclopent-2-en-1-yloxy-9-methyl-2-oxo-7-pentoxyoxonan-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate.
| Compound Name | tert-butyl N-[(8S,9S)-8-cyclopent-2-en-1-yloxy-9-methyl-2-oxo-7-pentoxyoxonan-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
|---|---|
| PubChem CID | 90259923 |
| Molecular Formula | C29H49NO8 |
| Molecular Weight | 539.71 g/mol |
| Exact Mass | 539.35 |
| IUPAC Name | tert-butyl N-[(8S,9S)-8-cyclopent-2-en-1-yloxy-9-methyl-2-oxo-7-pentoxyoxonan-3-yl]-N-[(2-methylpropan-2-yl)oxycarbonyl]carbamate |
| SMILES | CCCCCOC1CCCC(N(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C)C(=O)O[C@@H](C)[C@@H]1OC1C=CCC1 |
| InChI | InChI=1S/C29H49NO8/c1-9-10-13-19-34-23-18-14-17-22(25(31)35-20(2)24(23)36-21-15-11-12-16-21)30(26(32)37-28(3,4)5)27(33)38-29(6,7)8/h11,15,20-24H,9-10,12-14,16-19H2,1-8H3/t20-,21?,22?,23?,24-/m0/s1 |
| InChIKey | PHLMPVMQOZIQTR-XDLYSNNKSA-N |
| XLogP | 6.32 |
| TPSA | 100.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.71 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|