C29H31N5O3 — CID 90261329
N-[(2E,4E)-5-amino-4-[2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl]-1-oxopenta-2,4-dien-2-yl]-4-piperidin-1-ylbenzamide (PubChem CID 90261329) has the molecular formula C29H31N5O3 and a molecular weight of 497.60 g/mol. Its IUPAC name is N-[(2E,4E)-5-amino-4-[2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl]-1-oxopenta-2,4-dien-2-yl]-4-piperidin-1-ylbenzamide.
| Compound Name | N-[(2E,4E)-5-amino-4-[2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl]-1-oxopenta-2,4-dien-2-yl]-4-piperidin-1-ylbenzamide |
|---|---|
| PubChem CID | 90261329 |
| Molecular Formula | C29H31N5O3 |
| Molecular Weight | 497.60 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | N-[(2E,4E)-5-amino-4-[2-methyl-6-oxo-1-(pyridin-2-ylmethyl)-4-pyridinyl]-1-oxopenta-2,4-dien-2-yl]-4-piperidin-1-ylbenzamide |
| SMILES | Cc1cc(C(/C=C(\C=O)NC(=O)c2ccc(N3CCCCC3)cc2)=C/N)cc(=O)n1Cc1ccccn1 |
| InChI | InChI=1S/C29H31N5O3/c1-21-15-23(17-28(36)34(21)19-25-7-3-4-12-31-25)24(18-30)16-26(20-35)32-29(37)22-8-10-27(11-9-22)33-13-5-2-6-14-33/h3-4,7-12,15-18,20H,2,5-6,13-14,19,30H2,1H3,(H,32,37)/b24-18+,26-16+ |
| InChIKey | CPSCDODTEMDURC-NXBBQTBISA-N |
| XLogP | 3.40 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.60 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|