C23H25BN4O5 — CID 90266369
CID 90266369 (PubChem CID 90266369) has the molecular formula C23H25BN4O5 and a molecular weight of 448.29 g/mol.
| Compound Name | CID 90266369 |
|---|---|
| PubChem CID | 90266369 |
| Molecular Formula | C23H25BN4O5 |
| Molecular Weight | 448.29 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | — |
| SMILES | [B]N1CCC[C@H]2CN(c3ccc(-c4ccc5c(c4)OC[C@H]4[C@H](CO)OC(=O)N54)nc3)C[C@]21O |
| InChI | InChI=1S/C23H25BN4O5/c24-27-7-1-2-15-10-26(13-23(15,27)31)16-4-5-17(25-9-16)14-3-6-18-20(8-14)32-12-19-21(11-29)33-22(30)28(18)19/h3-6,8-9,15,19,21,29,31H,1-2,7,10-13H2/t15-,19-,21-,23-/m0/s1 |
| InChIKey | VJEWEFKVFDHQQD-SKRIEOTFSA-N |
| XLogP | 1.13 |
| TPSA | 98.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|