C30H42N4O4 — CID 90268207
2-[(E)-1-[4-[(1S,5R)-9-[2-[(1R)-3,3-dimethylcyclohexyl]ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid (PubChem CID 90268207) has the molecular formula C30H42N4O4 and a molecular weight of 522.69 g/mol. Its IUPAC name is 2-[(E)-1-[4-[(1S,5R)-9-[2-[(1R)-3,3-dimethylcyclohexyl]ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid.
| Compound Name | 2-[(E)-1-[4-[(1S,5R)-9-[2-[(1R)-3,3-dimethylcyclohexyl]ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid |
|---|---|
| PubChem CID | 90268207 |
| Molecular Formula | C30H42N4O4 |
| Molecular Weight | 522.69 g/mol |
| Exact Mass | 522.32 |
| IUPAC Name | 2-[(E)-1-[4-[(1S,5R)-9-[2-[(1R)-3,3-dimethylcyclohexyl]ethyl]-9-azabicyclo[3.3.1]nonan-3-yl]-3-oxoquinoxalin-2-yl]ethylideneamino]oxyacetic acid |
| SMILES | C/C(=N\OCC(=O)O)c1nc2ccccc2n(C2C[C@H]3CCC[C@@H](C2)N3CC[C@@H]2CCCC(C)(C)C2)c1=O |
| InChI | InChI=1S/C30H42N4O4/c1-20(32-38-19-27(35)36)28-29(37)34(26-12-5-4-11-25(26)31-28)24-16-22-9-6-10-23(17-24)33(22)15-13-21-8-7-14-30(2,3)18-21/h4-5,11-12,21-24H,6-10,13-19H2,1-3H3,(H,35,36)/b32-20+/t21-,22-,23+,24?/m0/s1 |
| InChIKey | HRCDPVQOUQXVBH-YYUYLFSNSA-N |
| XLogP | 5.39 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.69 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|