C40H33N3 — CID 90270103
(Z,3R)-4-carbazol-9-yl-1,3-bis(4-phenylphenyl)but-1-ene-1,4-diamine (PubChem CID 90270103) has the molecular formula C40H33N3 and a molecular weight of 555.73 g/mol. Its IUPAC name is (Z,3R)-4-carbazol-9-yl-1,3-bis(4-phenylphenyl)but-1-ene-1,4-diamine.
| Compound Name | (Z,3R)-4-carbazol-9-yl-1,3-bis(4-phenylphenyl)but-1-ene-1,4-diamine |
|---|---|
| PubChem CID | 90270103 |
| Molecular Formula | C40H33N3 |
| Molecular Weight | 555.73 g/mol |
| Exact Mass | 555.27 |
| IUPAC Name | (Z,3R)-4-carbazol-9-yl-1,3-bis(4-phenylphenyl)but-1-ene-1,4-diamine |
| SMILES | N/C(=C\[C@H](c1ccc(-c2ccccc2)cc1)C(N)n1c2ccccc2c2ccccc21)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C40H33N3/c41-37(33-25-21-31(22-26-33)29-13-5-2-6-14-29)27-36(32-23-19-30(20-24-32)28-11-3-1-4-12-28)40(42)43-38-17-9-7-15-34(38)35-16-8-10-18-39(35)43/h1-27,36,40H,41-42H2/b37-27-/t36-,40?/m1/s1 |
| InChIKey | AHYMEPBVBWGGSW-YTWZUEMNSA-N |
| XLogP | 9.37 |
| TPSA | 56.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.73 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |