C18H25F3O3S — CID 90276510
[(E)-11,11,11-trifluoroundec-8-enyl] 4-methylbenzenesulfonate (PubChem CID 90276510) has the molecular formula C18H25F3O3S and a molecular weight of 378.46 g/mol. Its IUPAC name is [(E)-11,11,11-trifluoroundec-8-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(E)-11,11,11-trifluoroundec-8-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 90276510 |
| Molecular Formula | C18H25F3O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [(E)-11,11,11-trifluoroundec-8-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCCCC/C=C/CC(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3O3S/c1-16-10-12-17(13-11-16)25(22,23)24-15-9-7-5-3-2-4-6-8-14-18(19,20)21/h6,8,10-13H,2-5,7,9,14-15H2,1H3/b8-6+ |
| InChIKey | KQMCEBWBPQPYLP-SOFGYWHQSA-N |
| XLogP | 5.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|