C31H32F6N4O4 — CID 90279094
[(3S,6R)-6-[2-[2-[[(2S)-1-amino-3,3-bis(3-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 90279094) has the molecular formula C31H32F6N4O4 and a molecular weight of 638.61 g/mol. Its IUPAC name is [(3S,6R)-6-[2-[2-[[(2S)-1-amino-3,3-bis(3-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6R)-6-[2-[2-[[(2S)-1-amino-3,3-bis(3-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 90279094 |
| Molecular Formula | C31H32F6N4O4 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | [(3S,6R)-6-[2-[2-[[(2S)-1-amino-3,3-bis(3-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenyl]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | NC(=O)[C@@H](Nc1cccc(F)c1CC[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1)C(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C31H32F6N4O4/c32-20-6-1-4-18(12-20)27(19-5-2-7-21(33)13-19)28(29(38)42)41-26-9-3-8-25(34)24(26)11-10-23-14-39-22(15-44-23)16-45-30(43)40-17-31(35,36)37/h1-9,12-13,22-23,27-28,39,41H,10-11,14-17H2,(H2,38,42)(H,40,43)/t22-,23+,28-/m0/s1 |
| InChIKey | RCCLXDBTKOXFAG-JWZKTCGFSA-N |
| XLogP | 4.78 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |