C31H32F6N4O5 — CID 90278992
[(3S,6S)-6-[(1S)-1-[2-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenoxy]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate (PubChem CID 90278992) has the molecular formula C31H32F6N4O5 and a molecular weight of 654.61 g/mol. Its IUPAC name is [(3S,6S)-6-[(1S)-1-[2-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenoxy]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate.
| Compound Name | [(3S,6S)-6-[(1S)-1-[2-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenoxy]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
|---|---|
| PubChem CID | 90278992 |
| Molecular Formula | C31H32F6N4O5 |
| Molecular Weight | 654.61 g/mol |
| Exact Mass | 654.23 |
| IUPAC Name | [(3S,6S)-6-[(1S)-1-[2-[[(2S)-1-amino-3,3-bis(4-fluorophenyl)-1-oxopropan-2-yl]amino]-6-fluorophenoxy]ethyl]morpholin-3-yl]methyl N-(2,2,2-trifluoroethyl)carbamate |
| SMILES | C[C@H](Oc1c(F)cccc1N[C@H](C(N)=O)C(c1ccc(F)cc1)c1ccc(F)cc1)[C@@H]1CN[C@H](COC(=O)NCC(F)(F)F)CO1 |
| InChI | InChI=1S/C31H32F6N4O5/c1-17(25-13-39-22(14-44-25)15-45-30(43)40-16-31(35,36)37)46-28-23(34)3-2-4-24(28)41-27(29(38)42)26(18-5-9-20(32)10-6-18)19-7-11-21(33)12-8-19/h2-12,17,22,25-27,39,41H,13-16H2,1H3,(H2,38,42)(H,40,43)/t17-,22-,25-,27-/m0/s1 |
| InChIKey | YKXCNLWWTMCKMI-UIULYTHOSA-N |
| XLogP | 4.61 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.61 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |