About CID 90280951
CID 90280951 (PubChem CID 90280951) has the molecular formula C22H31OSn
and a molecular weight of 430.20 g/mol.
Molecular Properties
| Compound Name | CID 90280951 |
| PubChem CID | 90280951 |
| Molecular Formula | C22H31OSn |
| Molecular Weight | 430.20 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | — |
| SMILES | CCCCc1c(CCCC)c(O[Sn])c2ccccc2c1CCCC |
| InChI | InChI=1S/C22H32O.Sn/c1-4-7-12-17-18(13-8-5-2)20(14-9-6-3)22(23)21-16-11-10-15-19(17)21;/h10-11,15-16,23H,4-9,12-14H2,1-3H3;/q;+1/p-1 |
| InChIKey | FIVKJIJHSOMVBP-UHFFFAOYSA-M |
| XLogP | 6.33 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.20 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 90280951 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 90280951?
The IUPAC name of CID 90280951 (CID 90280951) is not available.
What is the SMILES notation for CID 90280951?
The canonical SMILES for CID 90280951 is CCCCc1c(CCCC)c(O[Sn])c2ccccc2c1CCCC.
What is the InChIKey of CID 90280951?
The InChIKey is FIVKJIJHSOMVBP-UHFFFAOYSA-M. The full InChI is InChI=1S/C22H32O.Sn/c1-4-7-12-17-18(13-8-5-2)20(14-9-6-3)22(23)21-16-11-10-15-19(17)21;/h10-11,15-16,23H,4-9,12-14H2,1-3H3;/q;+1/p-1.
What are the key properties of CID 90280951?
CID 90280951 has a molecular weight of 430.20 g/mol, XLogP of 6.33, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 90280951 is sourced from PubChem (CID 90280951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).