C22H25ClN6O2S — CID 90282447
tert-butyl 2-[5-[2-chloro-4-(1H-pyrazol-4-yl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (PubChem CID 90282447) has the molecular formula C22H25ClN6O2S and a molecular weight of 473.00 g/mol. Its IUPAC name is tert-butyl 2-[5-[2-chloro-4-(1H-pyrazol-4-yl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate.
| Compound Name | tert-butyl 2-[5-[2-chloro-4-(1H-pyrazol-4-yl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
|---|---|
| PubChem CID | 90282447 |
| Molecular Formula | C22H25ClN6O2S |
| Molecular Weight | 473.00 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | tert-butyl 2-[5-[2-chloro-4-(1H-pyrazol-4-yl)phenyl]-1,3,4-thiadiazol-2-yl]-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC2CN(c3nnc(-c4ccc(-c5cn[nH]c5)cc4Cl)s3)CC2C1 |
| InChI | InChI=1S/C22H25ClN6O2S/c1-22(2,3)31-21(30)29-11-15-9-28(10-16(15)12-29)20-27-26-19(32-20)17-5-4-13(6-18(17)23)14-7-24-25-8-14/h4-8,15-16H,9-12H2,1-3H3,(H,24,25) |
| InChIKey | MQVUFAGXFXDFPW-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 87.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.00 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |