C12H21BrN4S — CID 90282612
5-bromo-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine (PubChem CID 90282612) has the molecular formula C12H21BrN4S and a molecular weight of 333.30 g/mol. Its IUPAC name is 5-bromo-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-bromo-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 90282612 |
| Molecular Formula | C12H21BrN4S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 5-bromo-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-1,3,4-thiadiazol-2-amine |
| SMILES | CN1C(C)(C)CC(Nc2nnc(Br)s2)CC1(C)C |
| InChI | InChI=1S/C12H21BrN4S/c1-11(2)6-8(7-12(3,4)17(11)5)14-10-16-15-9(13)18-10/h8H,6-7H2,1-5H3,(H,14,16) |
| InChIKey | CEDKSTVLUMEOLZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |