C27H34N4O3 — CID 90282629
8-cyclopentyl-6-[(3S,5R)-4-(furan-3-carbonyl)-3,5-dimethylpiperazin-1-yl]-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile (PubChem CID 90282629) has the molecular formula C27H34N4O3 and a molecular weight of 462.59 g/mol. Its IUPAC name is 8-cyclopentyl-6-[(3S,5R)-4-(furan-3-carbonyl)-3,5-dimethylpiperazin-1-yl]-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile.
| Compound Name | 8-cyclopentyl-6-[(3S,5R)-4-(furan-3-carbonyl)-3,5-dimethylpiperazin-1-yl]-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
|---|---|
| PubChem CID | 90282629 |
| Molecular Formula | C27H34N4O3 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 8-cyclopentyl-6-[(3S,5R)-4-(furan-3-carbonyl)-3,5-dimethylpiperazin-1-yl]-3,3-dimethyl-1,4-dihydropyrano[3,4-c]pyridine-5-carbonitrile |
| SMILES | C[C@@H]1CN(c2nc(C3CCCC3)c3c(c2C#N)CC(C)(C)OC3)C[C@H](C)N1C(=O)c1ccoc1 |
| InChI | InChI=1S/C27H34N4O3/c1-17-13-30(14-18(2)31(17)26(32)20-9-10-33-15-20)25-22(12-28)21-11-27(3,4)34-16-23(21)24(29-25)19-7-5-6-8-19/h9-10,15,17-19H,5-8,11,13-14,16H2,1-4H3/t17-,18+ |
| InChIKey | VMPTXHHJJULQBX-HDICACEKSA-N |
| XLogP | 4.79 |
| TPSA | 82.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |