C9H19N — CID 90284756
N,6-dimethylhept-1-en-1-amine (PubChem CID 90284756) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is N,6-dimethylhept-1-en-1-amine.
| Compound Name | N,6-dimethylhept-1-en-1-amine |
|---|---|
| PubChem CID | 90284756 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | N,6-dimethylhept-1-en-1-amine |
| SMILES | CNC=CCCCC(C)C |
| InChI | InChI=1S/C9H19N/c1-9(2)7-5-4-6-8-10-3/h6,8-10H,4-5,7H2,1-3H3 |
| InChIKey | RUILOCDZENKBOR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|