C28H30N4O6 — CID 90285602
(2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(1,3-benzodioxol-5-ylmethyl)-3-phenylpropanamide (PubChem CID 90285602) has the molecular formula C28H30N4O6 and a molecular weight of 518.57 g/mol. Its IUPAC name is (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(1,3-benzodioxol-5-ylmethyl)-3-phenylpropanamide.
| Compound Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(1,3-benzodioxol-5-ylmethyl)-3-phenylpropanamide |
|---|---|
| PubChem CID | 90285602 |
| Molecular Formula | C28H30N4O6 |
| Molecular Weight | 518.57 g/mol |
| Exact Mass | 518.22 |
| IUPAC Name | (2R)-2-[[amino-[[2-(3,4-dimethoxyphenyl)acetyl]amino]methylidene]amino]-N-(1,3-benzodioxol-5-ylmethyl)-3-phenylpropanamide |
| SMILES | COc1ccc(CC(=O)N/C(N)=N/[C@H](Cc2ccccc2)C(=O)NCc2ccc3c(c2)OCO3)cc1OC |
| InChI | InChI=1S/C28H30N4O6/c1-35-22-10-8-19(13-24(22)36-2)15-26(33)32-28(29)31-21(12-18-6-4-3-5-7-18)27(34)30-16-20-9-11-23-25(14-20)38-17-37-23/h3-11,13-14,21H,12,15-17H2,1-2H3,(H,30,34)(H3,29,31,32,33)/t21-/m1/s1 |
| InChIKey | QWVZXSNRAZWAEP-OAQYLSRUSA-N |
| XLogP | 2.33 |
| TPSA | 133.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.57 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|