About 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine
2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine (PubChem CID 90286692) has the molecular formula C8H9N5S
and a molecular weight of 207.26 g/mol. Its IUPAC name is 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine.
Analyze 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine?
The IUPAC name of 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine (CID 90286692) is 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine.
What is the SMILES notation for 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine?
The canonical SMILES for 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine is Nc1ccnn1-c1nc(C2CC2)ns1.
What is the InChIKey of 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine?
The InChIKey is QLRHFTBOZXWODN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5S/c9-6-3-4-10-13(6)8-11-7(12-14-8)5-1-2-5/h3-5H,1-2,9H2.
What are the key properties of 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine?
2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine has a molecular weight of 207.26 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-cyclopropyl-1,2,4-thiadiazol-5-yl)pyrazol-3-amine is sourced from PubChem (CID 90286692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).