C27H27N3 — CID 90286958
2,6-bis(2-benzyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine (PubChem CID 90286958) has the molecular formula C27H27N3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 2,6-bis(2-benzyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine.
| Compound Name | 2,6-bis(2-benzyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine |
|---|---|
| PubChem CID | 90286958 |
| Molecular Formula | C27H27N3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 2,6-bis(2-benzyl-3,4-dihydro-2H-pyrrol-5-yl)pyridine |
| SMILES | c1ccc(CC2CCC(c3cccc(C4=NC(Cc5ccccc5)CC4)n3)=N2)cc1 |
| InChI | InChI=1S/C27H27N3/c1-3-8-20(9-4-1)18-22-14-16-26(28-22)24-12-7-13-25(30-24)27-17-15-23(29-27)19-21-10-5-2-6-11-21/h1-13,22-23H,14-19H2 |
| InChIKey | WXDYTHFHNCMGCY-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 37.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |