C12H14BrNO3 — CID 90287744
3-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-4H-1,2-oxazol-4-ol (PubChem CID 90287744) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 3-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-4H-1,2-oxazol-4-ol.
| Compound Name | 3-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-4H-1,2-oxazol-4-ol |
|---|---|
| PubChem CID | 90287744 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 3-(3-bromo-4-methoxyphenyl)-5,5-dimethyl-4H-1,2-oxazol-4-ol |
| SMILES | COc1ccc(C2=NOC(C)(C)C2O)cc1Br |
| InChI | InChI=1S/C12H14BrNO3/c1-12(2)11(15)10(14-17-12)7-4-5-9(16-3)8(13)6-7/h4-6,11,15H,1-3H3 |
| InChIKey | NJBSWEBSPXNIEU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 51.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |