C14H12ClF3N2O3 — CID 90287747
ethyl 5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methylpyrazole-3-carboxylate (PubChem CID 90287747) has the molecular formula C14H12ClF3N2O3 and a molecular weight of 348.71 g/mol. Its IUPAC name is ethyl 5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methylpyrazole-3-carboxylate.
| Compound Name | ethyl 5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methylpyrazole-3-carboxylate |
|---|---|
| PubChem CID | 90287747 |
| Molecular Formula | C14H12ClF3N2O3 |
| Molecular Weight | 348.71 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | ethyl 5-[5-chloro-2-(trifluoromethoxy)phenyl]-1-methylpyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-c2cc(Cl)ccc2OC(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C14H12ClF3N2O3/c1-3-22-13(21)10-7-11(20(2)19-10)9-6-8(15)4-5-12(9)23-14(16,17)18/h4-7H,3H2,1-2H3 |
| InChIKey | OUDAJEPNZRMZGV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.71 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |