C18H20ClN5O — CID 90287821
4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propyl]morpholine (PubChem CID 90287821) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propyl]morpholine.
| Compound Name | 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propyl]morpholine |
|---|---|
| PubChem CID | 90287821 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]propyl]morpholine |
| SMILES | Clc1ccc2ncc(-c3cnn(CCCN4CCOCC4)c3)cc2n1 |
| InChI | InChI=1S/C18H20ClN5O/c19-18-3-2-16-17(22-18)10-14(11-20-16)15-12-21-24(13-15)5-1-4-23-6-8-25-9-7-23/h2-3,10-13H,1,4-9H2 |
| InChIKey | QUZJOLCSCDTZHT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|