C18H18ClF2N5O — CID 90289032
4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-2,2-difluoropropyl]morpholine (PubChem CID 90289032) has the molecular formula C18H18ClF2N5O and a molecular weight of 393.83 g/mol. Its IUPAC name is 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-2,2-difluoropropyl]morpholine.
| Compound Name | 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-2,2-difluoropropyl]morpholine |
|---|---|
| PubChem CID | 90289032 |
| Molecular Formula | C18H18ClF2N5O |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 4-[3-[4-(6-chloro-1,5-naphthyridin-3-yl)pyrazol-1-yl]-2,2-difluoropropyl]morpholine |
| SMILES | FC(F)(CN1CCOCC1)Cn1cc(-c2cnc3ccc(Cl)nc3c2)cn1 |
| InChI | InChI=1S/C18H18ClF2N5O/c19-17-2-1-15-16(24-17)7-13(8-22-15)14-9-23-26(10-14)12-18(20,21)11-25-3-5-27-6-4-25/h1-2,7-10H,3-6,11-12H2 |
| InChIKey | VPNQXVZDXAUQFD-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|