About N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine
N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine (PubChem CID 90291882) has the molecular formula C12H14N2
and a molecular weight of 186.26 g/mol. Its IUPAC name is N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine.
Molecular Properties
| Compound Name | N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine |
| PubChem CID | 90291882 |
| Molecular Formula | C12H14N2 |
| Molecular Weight | 186.26 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine |
| SMILES | C=C/N=C1/C2C=CC=CC2C=CN1C |
| InChI | InChI=1S/C12H14N2/c1-3-13-12-11-7-5-4-6-10(11)8-9-14(12)2/h3-11H,1H2,2H3/b13-12- |
| InChIKey | LEEKAPCGSQIPNX-SEYXRHQNSA-N |
| XLogP | 2.35 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine?
The IUPAC name of N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine (CID 90291882) is N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine.
What is the SMILES notation for N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine?
The canonical SMILES for N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine is C=C/N=C1/C2C=CC=CC2C=CN1C.
What is the InChIKey of N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine?
The InChIKey is LEEKAPCGSQIPNX-SEYXRHQNSA-N. The full InChI is InChI=1S/C12H14N2/c1-3-13-12-11-7-5-4-6-10(11)8-9-14(12)2/h3-11H,1H2,2H3/b13-12-.
What are the key properties of N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine?
N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine has a molecular weight of 186.26 g/mol, XLogP of 2.35, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethenyl-2-methyl-4a,8a-dihydroisoquinolin-1-imine is sourced from PubChem (CID 90291882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).