About 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate
1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate (PubChem CID 90294914) has the molecular formula C19H20FNO5
and a molecular weight of 361.37 g/mol. Its IUPAC name is 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate.
Molecular Properties
| Compound Name | 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate |
| PubChem CID | 90294914 |
| Molecular Formula | C19H20FNO5 |
| Molecular Weight | 361.37 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(OCc1ccc(-c2ccc(F)cc2)nc1)C(=O)OC |
| InChI | InChI=1S/C19H20FNO5/c1-4-25-18(23)19(2,17(22)24-3)26-12-13-5-10-16(21-11-13)14-6-8-15(20)9-7-14/h5-11H,4,12H2,1-3H3 |
| InChIKey | WFHZKPFAIWNDKK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate?
The IUPAC name of 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate (CID 90294914) is 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate.
What is the SMILES notation for 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate?
The canonical SMILES for 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate is CCOC(=O)C(C)(OCc1ccc(-c2ccc(F)cc2)nc1)C(=O)OC.
What is the InChIKey of 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate?
The InChIKey is WFHZKPFAIWNDKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H20FNO5/c1-4-25-18(23)19(2,17(22)24-3)26-12-13-5-10-16(21-11-13)14-6-8-15(20)9-7-14/h5-11H,4,12H2,1-3H3.
What are the key properties of 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate?
1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate has a molecular weight of 361.37 g/mol, XLogP of 2.90, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-ethyl 3-O-methyl 2-[[6-(4-fluorophenyl)-3-pyridinyl]methoxy]-2-methylpropanedioate is sourced from PubChem (CID 90294914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).