C47H32N4Si — CID 90296203
1-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,10,10-triphenyl-[1]benzosilolo[3,2-b]indole (PubChem CID 90296203) has the molecular formula C47H32N4Si and a molecular weight of 680.89 g/mol. Its IUPAC name is 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,10,10-triphenyl-[1]benzosilolo[3,2-b]indole.
| Compound Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,10,10-triphenyl-[1]benzosilolo[3,2-b]indole |
|---|---|
| PubChem CID | 90296203 |
| Molecular Formula | C47H32N4Si |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.24 |
| IUPAC Name | 1-(4,6-diphenyl-1,3,5-triazin-2-yl)-5,10,10-triphenyl-[1]benzosilolo[3,2-b]indole |
| SMILES | c1ccc(-c2nc(-c3ccccc3)nc(-c3cccc4c3[Si](c3ccccc3)(c3ccccc3)c3c-4n(-c4ccccc4)c4ccccc34)n2)cc1 |
| InChI | InChI=1S/C47H32N4Si/c1-6-19-33(20-7-1)45-48-46(34-21-8-2-9-22-34)50-47(49-45)40-31-18-30-39-42-44(38-29-16-17-32-41(38)51(42)35-23-10-3-11-24-35)52(43(39)40,36-25-12-4-13-26-36)37-27-14-5-15-28-37/h1-32H |
| InChIKey | MKPFROWVVFVPOQ-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|