C14H25NO4 — CID 90296516
[2,2-dimethyl-3-(2-prop-2-enoyloxyethylamino)propyl] 2-methylpropanoate (PubChem CID 90296516) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is [2,2-dimethyl-3-(2-prop-2-enoyloxyethylamino)propyl] 2-methylpropanoate.
| Compound Name | [2,2-dimethyl-3-(2-prop-2-enoyloxyethylamino)propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 90296516 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | [2,2-dimethyl-3-(2-prop-2-enoyloxyethylamino)propyl] 2-methylpropanoate |
| SMILES | C=CC(=O)OCCNCC(C)(C)COC(=O)C(C)C |
| InChI | InChI=1S/C14H25NO4/c1-6-12(16)18-8-7-15-9-14(4,5)10-19-13(17)11(2)3/h6,11,15H,1,7-10H2,2-5H3 |
| InChIKey | ULMYTQOEBMILAE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|