C13H7BrF2N2O — CID 90298562
2-(4-bromo-2,5-difluorophenyl)furo[2,3-c]pyridin-3-amine (PubChem CID 90298562) has the molecular formula C13H7BrF2N2O and a molecular weight of 325.11 g/mol. Its IUPAC name is 2-(4-bromo-2,5-difluorophenyl)furo[2,3-c]pyridin-3-amine.
| Compound Name | 2-(4-bromo-2,5-difluorophenyl)furo[2,3-c]pyridin-3-amine |
|---|---|
| PubChem CID | 90298562 |
| Molecular Formula | C13H7BrF2N2O |
| Molecular Weight | 325.11 g/mol |
| Exact Mass | 323.97 |
| IUPAC Name | 2-(4-bromo-2,5-difluorophenyl)furo[2,3-c]pyridin-3-amine |
| SMILES | Nc1c(-c2cc(F)c(Br)cc2F)oc2cnccc12 |
| InChI | InChI=1S/C13H7BrF2N2O/c14-8-4-9(15)7(3-10(8)16)13-12(17)6-1-2-18-5-11(6)19-13/h1-5H,17H2 |
| InChIKey | ZXJCUEIGACRVLB-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.11 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|