C24H18N6O3 — CID 90299379
1-(3-methoxyphenyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]triazole-4-carboxamide (PubChem CID 90299379) has the molecular formula C24H18N6O3 and a molecular weight of 438.45 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]triazole-4-carboxamide.
| Compound Name | 1-(3-methoxyphenyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]triazole-4-carboxamide |
|---|---|
| PubChem CID | 90299379 |
| Molecular Formula | C24H18N6O3 |
| Molecular Weight | 438.45 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | 1-(3-methoxyphenyl)-N-[4-(4-oxo-3H-phthalazin-1-yl)phenyl]triazole-4-carboxamide |
| SMILES | COc1cccc(-n2cc(C(=O)Nc3ccc(-c4n[nH]c(=O)c5ccccc45)cc3)nn2)c1 |
| InChI | InChI=1S/C24H18N6O3/c1-33-18-6-4-5-17(13-18)30-14-21(26-29-30)24(32)25-16-11-9-15(10-12-16)22-19-7-2-3-8-20(19)23(31)28-27-22/h2-14H,1H3,(H,25,32)(H,28,31) |
| InChIKey | FZHUFJQITNWIAE-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 114.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |