About methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate
methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate (PubChem CID 119051518) has the molecular formula C15H13N5O4
and a molecular weight of 327.30 g/mol. Its IUPAC name is methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate |
| PubChem CID | 119051518 |
| Molecular Formula | C15H13N5O4 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.10 |
| IUPAC Name | methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(-c2cccc(NC(=O)c3cc(C)on3)c2)nn1 |
| InChI | InChI=1S/C15H13N5O4/c1-9-6-12(18-24-9)14(21)16-10-4-3-5-11(7-10)20-8-13(17-19-20)15(22)23-2/h3-8H,1-2H3,(H,16,21) |
| InChIKey | RCLOLIXSHDXQKJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate?
The IUPAC name of methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate (CID 119051518) is methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate.
What is the SMILES notation for methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate?
The canonical SMILES for methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate is COC(=O)c1cn(-c2cccc(NC(=O)c3cc(C)on3)c2)nn1.
What is the InChIKey of methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate?
The InChIKey is RCLOLIXSHDXQKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N5O4/c1-9-6-12(18-24-9)14(21)16-10-4-3-5-11(7-10)20-8-13(17-19-20)15(22)23-2/h3-8H,1-2H3,(H,16,21).
What are the key properties of methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate?
methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate has a molecular weight of 327.30 g/mol, XLogP of 1.60, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-[3-[(5-methyl-1,2-oxazole-3-carbonyl)amino]phenyl]triazole-4-carboxylate is sourced from PubChem (CID 119051518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).