C16H18N4O5 — CID 139020454
1-[3-[[2-methoxy-2-(oxolan-3-yl)acetyl]amino]phenyl]triazole-4-carboxylic acid (PubChem CID 139020454) has the molecular formula C16H18N4O5 and a molecular weight of 346.34 g/mol. Its IUPAC name is 1-[3-[[2-methoxy-2-(oxolan-3-yl)acetyl]amino]phenyl]triazole-4-carboxylic acid.
| Compound Name | 1-[3-[[2-methoxy-2-(oxolan-3-yl)acetyl]amino]phenyl]triazole-4-carboxylic acid |
|---|---|
| PubChem CID | 139020454 |
| Molecular Formula | C16H18N4O5 |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 1-[3-[[2-methoxy-2-(oxolan-3-yl)acetyl]amino]phenyl]triazole-4-carboxylic acid |
| SMILES | COC(C(=O)Nc1cccc(-n2cc(C(=O)O)nn2)c1)C1CCOC1 |
| InChI | InChI=1S/C16H18N4O5/c1-24-14(10-5-6-25-9-10)15(21)17-11-3-2-4-12(7-11)20-8-13(16(22)23)18-19-20/h2-4,7-8,10,14H,5-6,9H2,1H3,(H,17,21)(H,22,23) |
| InChIKey | CAOSPRNWXNJJCH-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 115.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |