C24H24Cl2F7NO3 — CID 90301068
3-[[[3-(2,3-dichlorophenoxy)phenyl]-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexyl]methyl]amino]-1,1,1-trifluoropropan-2-ol (PubChem CID 90301068) has the molecular formula C24H24Cl2F7NO3 and a molecular weight of 578.35 g/mol. Its IUPAC name is 3-[[[3-(2,3-dichlorophenoxy)phenyl]-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexyl]methyl]amino]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 3-[[[3-(2,3-dichlorophenoxy)phenyl]-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 90301068 |
| Molecular Formula | C24H24Cl2F7NO3 |
| Molecular Weight | 578.35 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 3-[[[3-(2,3-dichlorophenoxy)phenyl]-[3-(1,1,2,2-tetrafluoroethoxy)cyclohexyl]methyl]amino]-1,1,1-trifluoropropan-2-ol |
| SMILES | OC(CNC(c1cccc(Oc2cccc(Cl)c2Cl)c1)C1CCCC(OC(F)(F)C(F)F)C1)C(F)(F)F |
| InChI | InChI=1S/C24H24Cl2F7NO3/c25-17-8-3-9-18(20(17)26)36-15-6-1-4-13(10-15)21(34-12-19(35)23(29,30)31)14-5-2-7-16(11-14)37-24(32,33)22(27)28/h1,3-4,6,8-10,14,16,19,21-22,34-35H,2,5,7,11-12H2 |
| InChIKey | AIKOBTJZGCMPSI-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.35 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|