C18H21N3OS — CID 9030369
2-(4-methyl-1,3-thiazol-2-yl)-N-[[(2R)-2-phenylcyclohexylidene]amino]acetamide (PubChem CID 9030369) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is 2-(4-methyl-1,3-thiazol-2-yl)-N-[[(2R)-2-phenylcyclohexylidene]amino]acetamide.
| Compound Name | 2-(4-methyl-1,3-thiazol-2-yl)-N-[[(2R)-2-phenylcyclohexylidene]amino]acetamide |
|---|---|
| PubChem CID | 9030369 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-(4-methyl-1,3-thiazol-2-yl)-N-[[(2R)-2-phenylcyclohexylidene]amino]acetamide |
| SMILES | Cc1csc(CC(=O)NN=C2CCCC[C@@H]2c2ccccc2)n1 |
| InChI | InChI=1S/C18H21N3OS/c1-13-12-23-18(19-13)11-17(22)21-20-16-10-6-5-9-15(16)14-7-3-2-4-8-14/h2-4,7-8,12,15H,5-6,9-11H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | QSUGVIVMPOEPTO-OAHLLOKOSA-N |
| XLogP | 3.82 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|