C12H15N3OS — CID 9028987
N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide (PubChem CID 9028987) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide.
| Compound Name | N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 9028987 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-[(E)-(3-methylcyclopent-2-en-1-ylidene)amino]-2-(4-methyl-1,3-thiazol-2-yl)acetamide |
| SMILES | CC1=C/C(=N/NC(=O)Cc2nc(C)cs2)CC1 |
| InChI | InChI=1S/C12H15N3OS/c1-8-3-4-10(5-8)14-15-11(16)6-12-13-9(2)7-17-12/h5,7H,3-4,6H2,1-2H3,(H,15,16)/b14-10+ |
| InChIKey | LPMUGIHIAOIZCI-GXDHUFHOSA-N |
| XLogP | 2.21 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|