C14H12ClN5O2S — CID 90303833
3-N-[2-(benzenesulfonyl)-3-chlorophenyl]-1H-1,2,4-triazole-3,5-diamine (PubChem CID 90303833) has the molecular formula C14H12ClN5O2S and a molecular weight of 349.80 g/mol. Its IUPAC name is 3-N-[2-(benzenesulfonyl)-3-chlorophenyl]-1H-1,2,4-triazole-3,5-diamine.
| Compound Name | 3-N-[2-(benzenesulfonyl)-3-chlorophenyl]-1H-1,2,4-triazole-3,5-diamine |
|---|---|
| PubChem CID | 90303833 |
| Molecular Formula | C14H12ClN5O2S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | 3-N-[2-(benzenesulfonyl)-3-chlorophenyl]-1H-1,2,4-triazole-3,5-diamine |
| SMILES | Nc1nc(Nc2cccc(Cl)c2S(=O)(=O)c2ccccc2)n[nH]1 |
| InChI | InChI=1S/C14H12ClN5O2S/c15-10-7-4-8-11(17-14-18-13(16)19-20-14)12(10)23(21,22)9-5-2-1-3-6-9/h1-8H,(H4,16,17,18,19,20) |
| InChIKey | YBJOMSVRVSUYEW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |