C11H17NO3 — CID 90303895
1,2-dimethyl-3-oxo-2,5,6,7,8,8a-hexahydroindolizine-1-carboxylic acid (PubChem CID 90303895) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 1,2-dimethyl-3-oxo-2,5,6,7,8,8a-hexahydroindolizine-1-carboxylic acid.
| Compound Name | 1,2-dimethyl-3-oxo-2,5,6,7,8,8a-hexahydroindolizine-1-carboxylic acid |
|---|---|
| PubChem CID | 90303895 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 1,2-dimethyl-3-oxo-2,5,6,7,8,8a-hexahydroindolizine-1-carboxylic acid |
| SMILES | CC1C(=O)N2CCCCC2C1(C)C(=O)O |
| InChI | InChI=1S/C11H17NO3/c1-7-9(13)12-6-4-3-5-8(12)11(7,2)10(14)15/h7-8H,3-6H2,1-2H3,(H,14,15) |
| InChIKey | VMGWPMWFUPRPNQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |