C31H20N2 — CID 90310248
17,18,19,20-tetradeuterio-10-phenyl-15-pyridin-3-yl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene (PubChem CID 90310248) has the molecular formula C31H20N2 and a molecular weight of 424.54 g/mol. Its IUPAC name is 17,18,19,20-tetradeuterio-10-phenyl-15-pyridin-3-yl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene.
| Compound Name | 17,18,19,20-tetradeuterio-10-phenyl-15-pyridin-3-yl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
|---|---|
| PubChem CID | 90310248 |
| Molecular Formula | C31H20N2 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 17,18,19,20-tetradeuterio-10-phenyl-15-pyridin-3-yl-10-azapentacyclo[11.8.0.03,11.04,9.016,21]henicosa-1,3(11),4,6,8,12,14,16,18,20-decaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c(-c3cccnc3)cc3cc4c(cc32)c2ccccc2n4-c2ccccc2)c1[2H] |
| InChI | InChI=1S/C31H20N2/c1-2-10-23(11-3-1)33-30-15-7-6-14-26(30)29-19-28-22(18-31(29)33)17-27(21-9-8-16-32-20-21)24-12-4-5-13-25(24)28/h1-20H/i4D,5D,12D,13D |
| InChIKey | AVYSZQHGRWDEFB-FVYLRRGISA-N |
| XLogP | 8.15 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|