C21H18Cl2FN3O4 — CID 90311836
(1S,11R,12R)-N-[(3,6-dichloro-2-fluorophenyl)methyl]-5-hydroxy-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxamide (PubChem CID 90311836) has the molecular formula C21H18Cl2FN3O4 and a molecular weight of 466.30 g/mol. Its IUPAC name is (1S,11R,12R)-N-[(3,6-dichloro-2-fluorophenyl)methyl]-5-hydroxy-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxamide.
| Compound Name | (1S,11R,12R)-N-[(3,6-dichloro-2-fluorophenyl)methyl]-5-hydroxy-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxamide |
|---|---|
| PubChem CID | 90311836 |
| Molecular Formula | C21H18Cl2FN3O4 |
| Molecular Weight | 466.30 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (1S,11R,12R)-N-[(3,6-dichloro-2-fluorophenyl)methyl]-5-hydroxy-3,6-dioxo-2,9-diazatetracyclo[10.2.1.02,11.04,9]pentadeca-4,7-diene-7-carboxamide |
| SMILES | O=C(NCc1c(Cl)ccc(Cl)c1F)c1cn2c(c(O)c1=O)C(=O)N1[C@H]3CC[C@H](C3)[C@@H]1C2 |
| InChI | InChI=1S/C21H18Cl2FN3O4/c22-13-3-4-14(23)16(24)11(13)6-25-20(30)12-7-26-8-15-9-1-2-10(5-9)27(15)21(31)17(26)19(29)18(12)28/h3-4,7,9-10,15,29H,1-2,5-6,8H2,(H,25,30)/t9-,10+,15+/m1/s1 |
| InChIKey | PKSXZGHVFJSXAT-FTGAXOIBSA-N |
| XLogP | 2.94 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|