C19H21N5O2S — CID 90313296
2-[6-(2-aminopyrimidin-5-yl)-3-pyridinyl]-N-tert-butylbenzenesulfonamide (PubChem CID 90313296) has the molecular formula C19H21N5O2S and a molecular weight of 383.48 g/mol. Its IUPAC name is 2-[6-(2-aminopyrimidin-5-yl)-3-pyridinyl]-N-tert-butylbenzenesulfonamide.
| Compound Name | 2-[6-(2-aminopyrimidin-5-yl)-3-pyridinyl]-N-tert-butylbenzenesulfonamide |
|---|---|
| PubChem CID | 90313296 |
| Molecular Formula | C19H21N5O2S |
| Molecular Weight | 383.48 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 2-[6-(2-aminopyrimidin-5-yl)-3-pyridinyl]-N-tert-butylbenzenesulfonamide |
| SMILES | CC(C)(C)NS(=O)(=O)c1ccccc1-c1ccc(-c2cnc(N)nc2)nc1 |
| InChI | InChI=1S/C19H21N5O2S/c1-19(2,3)24-27(25,26)17-7-5-4-6-15(17)13-8-9-16(21-10-13)14-11-22-18(20)23-12-14/h4-12,24H,1-3H3,(H2,20,22,23) |
| InChIKey | IRUCQZBBQVYUEZ-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.48 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |