C23H25FN6O3S — CID 90313760
[1-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]methylsulfonyl]piperidin-4-yl]urea (PubChem CID 90313760) has the molecular formula C23H25FN6O3S and a molecular weight of 484.56 g/mol. Its IUPAC name is [1-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]methylsulfonyl]piperidin-4-yl]urea.
| Compound Name | [1-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]methylsulfonyl]piperidin-4-yl]urea |
|---|---|
| PubChem CID | 90313760 |
| Molecular Formula | C23H25FN6O3S |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.17 |
| IUPAC Name | [1-[[2-[4-(5-aminopyrazin-2-yl)-3-fluorophenyl]phenyl]methylsulfonyl]piperidin-4-yl]urea |
| SMILES | NC(=O)NC1CCN(S(=O)(=O)Cc2ccccc2-c2ccc(-c3cnc(N)cn3)c(F)c2)CC1 |
| InChI | InChI=1S/C23H25FN6O3S/c24-20-11-15(5-6-19(20)21-12-28-22(25)13-27-21)18-4-2-1-3-16(18)14-34(32,33)30-9-7-17(8-10-30)29-23(26)31/h1-6,11-13,17H,7-10,14H2,(H2,25,28)(H3,26,29,31) |
| InChIKey | FDGGEAMZLQWJFV-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 144.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |