C22H28FN3O3 — CID 90315443
tert-butyl N-[(1S)-1-[4-[(3R)-1-(2-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]carbamate (PubChem CID 90315443) has the molecular formula C22H28FN3O3 and a molecular weight of 401.48 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-[4-[(3R)-1-(2-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-[4-[(3R)-1-(2-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]carbamate |
|---|---|
| PubChem CID | 90315443 |
| Molecular Formula | C22H28FN3O3 |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | tert-butyl N-[(1S)-1-[4-[(3R)-1-(2-fluoro-4-pyridinyl)pyrrolidin-3-yl]oxyphenyl]ethyl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)c1ccc(O[C@@H]2CCN(c3ccnc(F)c3)C2)cc1 |
| InChI | InChI=1S/C22H28FN3O3/c1-15(25-21(27)29-22(2,3)4)16-5-7-18(8-6-16)28-19-10-12-26(14-19)17-9-11-24-20(23)13-17/h5-9,11,13,15,19H,10,12,14H2,1-4H3,(H,25,27)/t15-,19+/m0/s1 |
| InChIKey | MUBQVIDLURBCCY-HNAYVOBHSA-N |
| XLogP | 4.46 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|