C19H18BrN3O2 — CID 90316012
tert-butyl N-[2-(4-bromophenyl)-1,6-naphthyridin-4-yl]carbamate (PubChem CID 90316012) has the molecular formula C19H18BrN3O2 and a molecular weight of 400.28 g/mol. Its IUPAC name is tert-butyl N-[2-(4-bromophenyl)-1,6-naphthyridin-4-yl]carbamate.
| Compound Name | tert-butyl N-[2-(4-bromophenyl)-1,6-naphthyridin-4-yl]carbamate |
|---|---|
| PubChem CID | 90316012 |
| Molecular Formula | C19H18BrN3O2 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | tert-butyl N-[2-(4-bromophenyl)-1,6-naphthyridin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1cc(-c2ccc(Br)cc2)nc2ccncc12 |
| InChI | InChI=1S/C19H18BrN3O2/c1-19(2,3)25-18(24)23-17-10-16(12-4-6-13(20)7-5-12)22-15-8-9-21-11-14(15)17/h4-11H,1-3H3,(H,22,23,24) |
| InChIKey | QMPLHFFIDXBXFF-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |