C25H22F3N5O4S — CID 90316147
1,1,1-trifluoro-N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide (PubChem CID 90316147) has the molecular formula C25H22F3N5O4S and a molecular weight of 545.54 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 90316147 |
| Molecular Formula | C25H22F3N5O4S |
| Molecular Weight | 545.54 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | 1,1,1-trifluoro-N-[3-[4-[4-[4-(hydrazinecarbonyl)-1,6-naphthyridin-2-yl]phenyl]phenoxy]propyl]methanesulfonamide |
| SMILES | NNC(=O)c1cc(-c2ccc(-c3ccc(OCCCNS(=O)(=O)C(F)(F)F)cc3)cc2)nc2ccncc12 |
| InChI | InChI=1S/C25H22F3N5O4S/c26-25(27,28)38(35,36)31-11-1-13-37-19-8-6-17(7-9-19)16-2-4-18(5-3-16)23-14-20(24(34)33-29)21-15-30-12-10-22(21)32-23/h2-10,12,14-15,31H,1,11,13,29H2,(H,33,34) |
| InChIKey | TZOGOXBWXVSHSG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 136.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|