C31H35ClN4O2 — CID 90316455
N-[3-chloro-4-[4-(5-methyl-6-oxo-11H-benzo[c][1]benzazepin-11-yl)piperazin-1-yl]phenyl]-2-ethylbutanamide (PubChem CID 90316455) has the molecular formula C31H35ClN4O2 and a molecular weight of 531.10 g/mol. Its IUPAC name is N-[3-chloro-4-[4-(5-methyl-6-oxo-11H-benzo[c][1]benzazepin-11-yl)piperazin-1-yl]phenyl]-2-ethylbutanamide.
| Compound Name | N-[3-chloro-4-[4-(5-methyl-6-oxo-11H-benzo[c][1]benzazepin-11-yl)piperazin-1-yl]phenyl]-2-ethylbutanamide |
|---|---|
| PubChem CID | 90316455 |
| Molecular Formula | C31H35ClN4O2 |
| Molecular Weight | 531.10 g/mol |
| Exact Mass | 530.24 |
| IUPAC Name | N-[3-chloro-4-[4-(5-methyl-6-oxo-11H-benzo[c][1]benzazepin-11-yl)piperazin-1-yl]phenyl]-2-ethylbutanamide |
| SMILES | CCC(CC)C(=O)Nc1ccc(N2CCN(C3c4ccccc4C(=O)N(C)c4ccccc43)CC2)c(Cl)c1 |
| InChI | InChI=1S/C31H35ClN4O2/c1-4-21(5-2)30(37)33-22-14-15-28(26(32)20-22)35-16-18-36(19-17-35)29-23-10-6-7-11-24(23)31(38)34(3)27-13-9-8-12-25(27)29/h6-15,20-21,29H,4-5,16-19H2,1-3H3,(H,33,37) |
| InChIKey | RBIZKZGAWHOHNZ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.10 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|