C22H22ClF3N6 — CID 90318338
8-(2-chloroethyl)-6-(2-cyclobutylethylamino)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carbonitrile (PubChem CID 90318338) has the molecular formula C22H22ClF3N6 and a molecular weight of 462.91 g/mol. Its IUPAC name is 8-(2-chloroethyl)-6-(2-cyclobutylethylamino)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carbonitrile.
| Compound Name | 8-(2-chloroethyl)-6-(2-cyclobutylethylamino)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carbonitrile |
|---|---|
| PubChem CID | 90318338 |
| Molecular Formula | C22H22ClF3N6 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 8-(2-chloroethyl)-6-(2-cyclobutylethylamino)-7-[[4-(trifluoromethyl)phenyl]methyl]purine-2-carbonitrile |
| SMILES | N#Cc1nc(NCCC2CCC2)c2c(n1)nc(CCCl)n2Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22ClF3N6/c23-10-8-18-31-21-19(32(18)13-15-4-6-16(7-5-15)22(24,25)26)20(29-17(12-27)30-21)28-11-9-14-2-1-3-14/h4-7,14H,1-3,8-11,13H2,(H,28,29,30) |
| InChIKey | VHGYADZYHIEKAF-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 79.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|