C28H29ClN6O2 — CID 90318533
7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[2-(3-hydroxypropoxy)-5-methylphenyl]purine-2-carbonitrile (PubChem CID 90318533) has the molecular formula C28H29ClN6O2 and a molecular weight of 517.03 g/mol. Its IUPAC name is 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[2-(3-hydroxypropoxy)-5-methylphenyl]purine-2-carbonitrile.
| Compound Name | 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[2-(3-hydroxypropoxy)-5-methylphenyl]purine-2-carbonitrile |
|---|---|
| PubChem CID | 90318533 |
| Molecular Formula | C28H29ClN6O2 |
| Molecular Weight | 517.03 g/mol |
| Exact Mass | 516.20 |
| IUPAC Name | 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[2-(3-hydroxypropoxy)-5-methylphenyl]purine-2-carbonitrile |
| SMILES | Cc1ccc(OCCCO)c(-c2nc3nc(C#N)nc(NCCC4CC4)c3n2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C28H29ClN6O2/c1-18-3-10-23(37-14-2-13-36)22(15-18)28-34-27-25(35(28)17-20-6-8-21(29)9-7-20)26(32-24(16-30)33-27)31-12-11-19-4-5-19/h3,6-10,15,19,36H,2,4-5,11-14,17H2,1H3,(H,31,32,33) |
| InChIKey | PALFFERRKFUFNO-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 108.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.03 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|